4,4'-Thio-bis(2-methyl-6-tert-butylphenol) structure
|
Common Name | 4,4'-Thio-bis(2-methyl-6-tert-butylphenol) | ||
|---|---|---|---|---|
| CAS Number | 96-66-2 | Molecular Weight | 358.53700 | |
| Density | 1.11g/cm3 | Boiling Point | 316 °C/40 mmHg(lit.) | |
| Molecular Formula | C22H30O2S | Melting Point | 127°C | |
| MSDS | N/A | Flash Point | 241 °C | |
| Name | 4,4'-Thiobis(6-tert-butyl-o-cresol) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 316 °C/40 mmHg(lit.) |
| Melting Point | 127°C |
| Molecular Formula | C22H30O2S |
| Molecular Weight | 358.53700 |
| Flash Point | 241 °C |
| Exact Mass | 358.19700 |
| PSA | 65.76000 |
| LogP | 6.46080 |
| Index of Refraction | 1.594 |
| InChIKey | YFHKLSPMRRWLKI-UHFFFAOYSA-N |
| SMILES | Cc1cc(Sc2cc(C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39-S37/39 |
| RTECS | GP3200000 |
| HS Code | 2930909090 |
|
~%
4,4'-Thio-bis(2... CAS#:96-66-2 |
| Literature: Journal of the Chemical Society. Perkin Transactions 2, , # 4 p. 885 - 888 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Cell survival assay for modulators of telomere damage signalling
Source: 15378
Target: N/A
External Id: TELO_02
|
|
Name: qHTS assay for inhibitors of human lactate dehydrogenase
Source: NCGC
Target: N/A
External Id: LDHA
|
|
Name: Primary qHTS Assay for Foot and Mouth Disease Virus Antivirals against NCGC Sytravon ...
Source: NCGC
External Id: stopgo-p2-SytraCBC-dual-FF
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Primary qHTS Assay for Foot and Mouth Disease Virus Antivirals against NCGC Sytravon ...
Source: NCGC
External Id: stopgo-p2-SytraCBC-dual-Ren
|
| EINECS 202-522-6 |
| MFCD00008823 |
| 4,4'-Thiobis(2-methyl-6-tert-butylphenol) |