Benzanilide, N-methyl-4-nitro-
Modify Date: 2025-08-26 04:31:16
Benzanilide, N-methyl-4-nitro- structure
|
Common Name | Benzanilide, N-methyl-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 961-61-5 | Molecular Weight | 256.25700 | |
| Density | 1.289g/cm3 | Boiling Point | 435.2ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217ºC | |
| Name | N-Methyl-4-nitrobenzanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 435.2ºC at 760 mmHg |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.25700 |
| Flash Point | 217ºC |
| Exact Mass | 256.08500 |
| PSA | 66.13000 |
| LogP | 3.39460 |
| Index of Refraction | 1.645 |
| InChIKey | MVDGHRIRJFXONZ-UHFFFAOYSA-N |
| SMILES | CN(C(=O)c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
CAS#:14309-78-5
CAS#:100-61-8
CAS#:784-94-1
CAS#:61821-45-2| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Nitro-N-methyl-N-phenylbenzamide |
| N-Methyl-N-phenyl-4-nitrobenzamide |
| N-Phenyl-N-methyl-4-nitrobenzamide |
| N-methyl-4-nitro-N-phenylbenzamide |