Benzamide,N-methyl-4-nitro- structure
|
Common Name | Benzamide,N-methyl-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 2585-23-1 | Molecular Weight | 180.16100 | |
| Density | 1.272g/cm3 | Boiling Point | 382.6ºC at 760mmHg | |
| Molecular Formula | C8H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.2ºC | |
| Name | N-methyl-4-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 382.6ºC at 760mmHg |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16100 |
| Flash Point | 185.2ºC |
| Exact Mass | 180.05300 |
| PSA | 74.92000 |
| LogP | 1.86850 |
| Vapour Pressure | 4.65E-06mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | UZWAQQSVGQEZRY-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-nitro-benzoic acid N-methyl amide |
| 4-nitro-benzoic acid methylamide |
| 4-nitro-N-methylbenzamide |
| N-Methyl-4-nitro-benzamide |
| Benzamide,N-methyl-p-nitro |
| N-Methyl-p-nitrobenzamide |
| Benzamide,N-methyl-4-nitro |