1-Bromoethyl 1-naphthylacetate structure
|
Common Name | 1-Bromoethyl 1-naphthylacetate | ||
|---|---|---|---|---|
| CAS Number | 96155-82-7 | Molecular Weight | 293.156 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 383.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H13BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.5±23.2 °C | |
| Name | ethyl 2-bromo-2-naphthalen-1-ylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 383.2±25.0 °C at 760 mmHg |
| Molecular Formula | C14H13BrO2 |
| Molecular Weight | 293.156 |
| Flash Point | 185.5±23.2 °C |
| Exact Mass | 292.009888 |
| PSA | 26.30000 |
| LogP | 4.31 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | KDAKWXQNGGIRDK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Br)c1cccc2ccccc12 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2916399090 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-Bromoethyl 1-naphthylacetate |
| 1-Naphthaleneacetic acid, 1-bromoethyl ester |