(+)-MK801MALEATE
Modify Date: 2025-08-27 14:34:39
(+)-MK801MALEATE structure
|
Common Name | (+)-MK801MALEATE | ||
|---|---|---|---|---|
| CAS Number | 96303-88-7 | Molecular Weight | 397.61500 | |
| Density | 1.16g/cm3 | Boiling Point | 520.4ºC at 760mmHg | |
| Molecular Formula | C22H39NO3S | Melting Point | 159-162ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 268.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (+)-n,n-dicyclohexyl-(1r)-isoborneol-10-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 520.4ºC at 760mmHg |
| Melting Point | 159-162ºC(lit.) |
| Molecular Formula | C22H39NO3S |
| Molecular Weight | 397.61500 |
| Flash Point | 268.5ºC |
| Exact Mass | 397.26500 |
| PSA | 65.99000 |
| LogP | 5.55160 |
| Index of Refraction | 1.558 |
| InChIKey | UOFKHCXOCUOSKA-UHFFFAOYSA-N |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)C(O)C2 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| MFCD00151335 |
| (-)-10-(N,N-Dicyclohexylsulfamoyl)-D-isoborneol |
| (1S,2R,4R)-1-(dicyclohexylaminosulfonyl)methyl-7,7-dimethylbicyclo<2.2.1>heptan-2-ol |
| (1S,2R)-N,N-dicyclohexyl-10-sulphamidoisoborneol |
| (1S,2R,4R)-10-dicyclohexylsulfamoylisoborneol |
| (-)-N,N-dicyclohexyl-1(1S)-isoborneol-10-sulfonamide |