6-O-Methyldeoxyguanosine structure
|
Common Name | 6-O-Methyldeoxyguanosine | ||
|---|---|---|---|---|
| CAS Number | 964-21-6 | Molecular Weight | 281.27 | |
| Density | 1.84 g/cm3 | Boiling Point | 674.7ºC at 760 mmHg | |
| Molecular Formula | C11H15N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 361.9ºC | |
Use of 6-O-MethyldeoxyguanosineO6-Methyldeoxy guanosine; DNA adduct is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | O6-methyl-2'-deoxyguanosine |
|---|---|
| Synonym | More Synonyms |
| Description | O6-Methyldeoxy guanosine; DNA adduct is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.84 g/cm3 |
|---|---|
| Boiling Point | 674.7ºC at 760 mmHg |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 |
| Flash Point | 361.9ºC |
| Exact Mass | 281.11200 |
| PSA | 128.54000 |
| Index of Refraction | 1.794 |
| InChIKey | BCKDNMPYCIOBTA-RRKCRQDMSA-N |
| SMILES | COc1nc(N)nc2c1ncn2C1CC(O)C(CO)O1 |
| Storage condition | 2-8°C |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| O6-methyl-2'-deoxy-guanosine |
| 2-Amino-6-methoxy-2'-deoxy-6-deaminoadenosine |
| 6-O-METHYL-2'-DEOXYGUANOSINE |
| O(6)-methyl-2'-deoxyguanosine |
| O6-METHYL-2'-DEOXYGUANOSINE |
| O6-methyldeoxyguanosine |