1,3-Propanediol, 2-((8-fluoranthenylmethyl)amino)-2-methyl- structure
|
Common Name | 1,3-Propanediol, 2-((8-fluoranthenylmethyl)amino)-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 96403-45-1 | Molecular Weight | 319.39700 | |
| Density | 1.286g/cm3 | Boiling Point | 570.6ºC at 760mmHg | |
| Molecular Formula | C21H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.1ºC | |
| Name | 2-(fluoranthen-8-ylmethylamino)-2-methylpropane-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 570.6ºC at 760mmHg |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.39700 |
| Flash Point | 190.1ºC |
| Exact Mass | 319.15700 |
| PSA | 52.49000 |
| LogP | 3.71100 |
| Index of Refraction | 1.764 |
| InChIKey | BNZUDBQCSFCEQB-UHFFFAOYSA-N |
| SMILES | CC(CO)(CO)NCc1ccc2c(c1)-c1cccc3cccc-2c13 |
| HS Code | 2922199090 |
|---|
|
~%
1,3-Propanediol... CAS#:96403-45-1 |
| Literature: Bair; Andrews; Tuttle; Knick; Cory; McKee Journal of Medicinal Chemistry, 1991 , vol. 34, # 7 p. 1983 - 1990 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,3-Propanediol,2-((8-fluoranthenylmethyl)amino)-2-methyl |
| 2-((8-Fluoranthenylmethyl)amino)-2-methyl-1,3-propanediol |