3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propyl 2-methylprop-2-enoate structure
|
Common Name | 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 96478-15-8 | Molecular Weight | 427.92400 | |
| Density | 1.22g/cm3 | Boiling Point | 576.1ºC at 760mmHg | |
| Molecular Formula | C23H26ClN3O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 302.2ºC | |
| Name | 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 576.1ºC at 760mmHg |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.92400 |
| Flash Point | 302.2ºC |
| Exact Mass | 427.16600 |
| PSA | 77.24000 |
| LogP | 5.12890 |
| Index of Refraction | 1.594 |
| InChIKey | RLWDBZIHAUEHLO-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCCc1cc(-n2nc3ccc(Cl)cc3n2)c(O)c(C(C)(C)C)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| RIDADR | NONH for all modes of transport |
| a-6748 |