ethyl 4-chloro-3-formyl-5,6-dihydro-2H-pyridine-1-carboxylate structure
|
Common Name | ethyl 4-chloro-3-formyl-5,6-dihydro-2H-pyridine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 96507-72-1 | Molecular Weight | 217.64900 | |
| Density | 1.27g/cm3 | Boiling Point | 318.8ºC at 760mmHg | |
| Molecular Formula | C9H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.6ºC | |
| Name | ethyl 4-chloro-5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 318.8ºC at 760mmHg |
| Molecular Formula | C9H12ClNO3 |
| Molecular Weight | 217.64900 |
| Flash Point | 146.6ºC |
| Exact Mass | 217.05100 |
| PSA | 46.61000 |
| LogP | 1.47830 |
| Index of Refraction | 1.521 |
| InChIKey | BMUCDCSKVFZPSS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(Cl)=C(C=O)C1 |
| HS Code | 2933399090 |
|---|
|
~76%
ethyl 4-chloro-... CAS#:96507-72-1 |
| Literature: Kikuchi, Chika; Hiranuma, Toyokazu; Koyama, Masao Bioorganic and Medicinal Chemistry Letters, 2002 , vol. 12, # 18 p. 2549 - 2552 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 4-chloro-3-formyl-5,6-dihydro-2H-pyridine-1-carboxylate |
| 4-chloro-1-ethoxycarbonyl-3-formyl-1,2,5,6-tetrahydropyridine |
| ethyl 4-chloro-3-formyl-5,6-dihydropyridine-1(2H)-carboxylate |
| EINECS 306-150-6 |