1,3-bis(5-amino-2-methylphenyl)urea structure
|
Common Name | 1,3-bis(5-amino-2-methylphenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 96616-17-0 | Molecular Weight | 270.33000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis(5-amino-2-methylphenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H18N4O |
|---|---|
| Molecular Weight | 270.33000 |
| Exact Mass | 270.14800 |
| PSA | 96.66000 |
| LogP | 4.36080 |
| InChIKey | KLLHGOCRQSWCNG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N)cc1NC(=O)Nc1cc(N)ccc1C |
|
~69%
1,3-bis(5-amino... CAS#:96616-17-0 |
| Literature: Turner, William R.; Werbel, Leslie M. Journal of Medicinal Chemistry, 1985 , vol. 28, # 11 p. 1728 - 1740 |
|
~%
1,3-bis(5-amino... CAS#:96616-17-0 |
| Literature: Turner, William R.; Werbel, Leslie M. Journal of Medicinal Chemistry, 1985 , vol. 28, # 11 p. 1728 - 1740 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-(3-amino-6-methylphenyl)[(3-amino-6-methylphenyl)amino]carboxamide |
| N,N'-Bis-(5-amino-2-methyl-phenyl)-harnstoff |
| 1,3-bis(2-methyl-5-aminophenyl)-urea |
| N,N'-bis-(5-amino-2-methyl-phenyl)-urea |
| Urea,N,N'-bis(5-amino-2-methylphenyl) |