Maoecrystal B structure
|
Common Name | Maoecrystal B | ||
|---|---|---|---|---|
| CAS Number | 96850-29-2 | Molecular Weight | 388.454 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 534.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H28O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.6±23.6 °C | |
Use of Maoecrystal BMaoecrystal B is a diterpenoids compound isolated from the leaves of Isodon eriocalyx var. laxiflora[1]. |
| Name | Maoecrystal B |
|---|---|
| Synonym | More Synonyms |
| Description | Maoecrystal B is a diterpenoids compound isolated from the leaves of Isodon eriocalyx var. laxiflora[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 534.8±50.0 °C at 760 mmHg |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.454 |
| Flash Point | 184.6±23.6 °C |
| Exact Mass | 388.188599 |
| PSA | 93.06000 |
| LogP | 2.78 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | KNRAGAKNFNKKQF-FXSDCIRHSA-N |
| SMILES | C=C1C2CCC3C45COC(O)(C(O)C4C(C)(C)C=CC5=O)C3(C2)C1OC(C)=O |
| Hazard Codes | Xi |
|---|
| (5β,6β,7α,8α,9β,10α,13α,15β)-6,7-Dihydroxy-1-oxo-7,20-epoxykaura-2,16-dien-15-yl acetate |