Maoecrystal A structure
|
Common Name | Maoecrystal A | ||
|---|---|---|---|---|
| CAS Number | 96850-30-5 | Molecular Weight | 388.454 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 550.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H28O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.1±23.6 °C | |
Use of Maoecrystal AMaoecrystal A is a compound isolated from leaves of Isodon eriocalyx[1]. |
| Name | Kaur-16-ene-1,7-dione, 15-(acetyloxy)-3,20-epoxy-6-hydroxy-, (3α,6β,15β)- |
|---|---|
| Synonym | More Synonyms |
| Description | Maoecrystal A is a compound isolated from leaves of Isodon eriocalyx[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 550.8±50.0 °C at 760 mmHg |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.454 |
| Flash Point | 191.1±23.6 °C |
| Exact Mass | 388.188599 |
| PSA | 89.90000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | DCULYKVTBAXAER-XETVFITMSA-N |
| SMILES | C=C1C2CCC3C(C2)(C(=O)C(O)C2C(C)(C)C4CC(=O)C23CO4)C1OC(C)=O |
| MAOECRYSTAL A |
| MaoecrystalA |
| (3α,5β,6β,8α,9β,10α,13α,15β)-6-Hydroxy-1,7-dioxo-3,20-epoxykaur-16-en-15-yl acetate |