Benzenesulfonic acid,4-methyl-3-nitro structure
|
Common Name | Benzenesulfonic acid,4-methyl-3-nitro | ||
|---|---|---|---|---|
| CAS Number | 97-06-3 | Molecular Weight | 217.19900 | |
| Density | 1.547g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H7NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-3-nitrobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.547g/cm3 |
|---|---|
| Molecular Formula | C7H7NO5S |
| Molecular Weight | 217.19900 |
| Exact Mass | 217.00400 |
| PSA | 108.57000 |
| LogP | 2.75390 |
| Index of Refraction | 1.596 |
| InChIKey | GJYYWZTYFNSZRP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-nitro-toluene-4-sulfonic acid |
| 2-nitro-p-toluenesulfonic acid |
| 2-Nitro-toluol-sulfonsaeure-(4) |
| 2-Nitro-p-toluenesulphonic acid |
| 4-Methyl-3-nitrobenzensulfonic acid |
| 2-Nitro-toluol-4-sulfonsaeure |
| EINECS 202-556-1 |
| 4-methyl-3-nitro-benzenesulfonic acid |