[1,1'-Biphenyl]-2,2'-disulfonicacid, 4,4'-diamino-5,5'-dimethyl- structure
|
Common Name | [1,1'-Biphenyl]-2,2'-disulfonicacid, 4,4'-diamino-5,5'-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 83-83-0 | Molecular Weight | 372.41700 | |
| Density | 1.568g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | o-toluidine disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.568g/cm3 |
|---|---|
| Molecular Formula | C14H16N2O6S2 |
| Molecular Weight | 372.41700 |
| Exact Mass | 372.04500 |
| PSA | 177.54000 |
| LogP | 4.95220 |
| Index of Refraction | 1.669 |
| InChIKey | PHICKPBIPXXFIP-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2cc(C)c(N)cc2S(=O)(=O)O)c(S(=O)(=O)O)cc1N |
| HS Code | 2921590090 |
|---|
|
~%
[1,1'-Biphenyl]... CAS#:83-83-0 |
| Literature: Elbs; Wohlfahrt Journal fuer Praktische Chemie (Leipzig), 1902 , vol. <2> 66, p. 570 |
|
~%
[1,1'-Biphenyl]... CAS#:83-83-0 |
| Literature: Helle Justus Liebigs Annalen der Chemie, 1892 , vol. 270, p. 366 |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4'-diamino-5,5'-dimethyl-biphenyl-2,2'-disulfonic acid |
| 4,4'-Diamino-3,3'-dimethylbiphenyl-6,6'-disulfonic acid |
| o-tolidine-6,6'-disulfonic acid |
| 4,4'-Diamino-5,5'-dimethyl-biphenyl-2,2'-disulfonsaeure |
| Orthotoludine66`disulfonicAcid |
| 4,4'-diamino-5,5'-dimethylbiphenyl-2,2'-disulphonic acid |
| 3,3'-dimethyl-4,4'-diaminobiphenyl-6,6'-disulfonic acid |