Resorcinol sulfide
Modify Date: 2026-07-14 19:31:58
Resorcinol sulfide structure
|
Common Name | Resorcinol sulfide | ||
|---|---|---|---|---|
| CAS Number | 97-29-0 | Molecular Weight | 250.27000 | |
| Density | 1.63g/cm3 | Boiling Point | 532.4ºC at 760mmHg | |
| Molecular Formula | C12H10O4S | Melting Point | 173-177 °C | |
| MSDS | N/A | Flash Point | 258ºC | |
| Name | 4-(2,4-dihydroxyphenyl)sulfanylbenzene-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 532.4ºC at 760mmHg |
| Melting Point | 173-177 °C |
| Molecular Formula | C12H10O4S |
| Molecular Weight | 250.27000 |
| Flash Point | 258ºC |
| Exact Mass | 250.03000 |
| PSA | 106.22000 |
| LogP | 2.66020 |
| Index of Refraction | 1.804 |
| InChIKey | WEMYXYMZQRSPIA-UHFFFAOYSA-N |
| SMILES | Oc1ccc(Sc2ccc(O)cc2O)c(O)c1 |
| Hazard Codes | Xi:Irritant |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25-S36-S26 |
| HS Code | 2930909090 |
|
~%
Resorcinol sulfide CAS#:97-29-0 |
| Literature: Journal of the American Chemical Society, , vol. 53, p. 3466 |
|
~%
Resorcinol sulfide CAS#:97-29-0 |
| Literature: Journal of the American Chemical Society, , vol. 53, p. 3466 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
Total 8, Current Page 1 of 1
1
| 4,4'-Thiobis(resorcinol) |
| 2,4,2',4'-tetrahydroxydiphenyl sulfide |
| 2,4-Dihydroxyphenyl sulfide |
| 4,4'-sulfanediyl-di-resorcinol |
| 1,3-Benzenediol,4,4'-thiobis |
| 4,4'-Thiodiresorcinol |
| Bis-(2.4-dihydroxy-phenyl)-sulfid |
| bis(2,4-dihydroxoybenzo)sulphide |
| 4,4'-Diresorcyl sulfide |
| 2,2',4,4'-Tetrahydroxydiphenyl sulfide |
| Bis(2,4-dihydroxyphenyl) sulfide |
| MFCD00045769 |
| 4,4'-Sulfandiyl-di-resorcin |
| EINECS 202-570-8 |