2,4-dinitro-N-(4-nitrophenyl)aniline structure
|
Common Name | 2,4-dinitro-N-(4-nitrophenyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 970-76-3 | Molecular Weight | 304.21500 | |
| Density | 1.592g/cm3 | Boiling Point | 491.1ºC at 760mmHg | |
| Molecular Formula | C12H8N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.8ºC | |
| Name | 2,4-dinitro-N-(4-nitrophenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.592g/cm3 |
|---|---|
| Boiling Point | 491.1ºC at 760mmHg |
| Molecular Formula | C12H8N4O6 |
| Molecular Weight | 304.21500 |
| Flash Point | 250.8ºC |
| Exact Mass | 304.04400 |
| PSA | 149.49000 |
| LogP | 4.79740 |
| Index of Refraction | 1.717 |
| InChIKey | MQZAHSOZWFOSGD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| HS Code | 2921420090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,4,4'-Trinitro-diphenylamin |
| N-(4-nitrophenyl)-2,4-dinitroaniline |
| (2,4-dinitro-phenyl)-(4-nitro-phenyl)-amine |
| N1-(4-nitrophenyl)-2,4-dinitroaniline |
| (2,4-Dinitro-phenyl)-(4-nitro-phenyl)-amin |
| EINECS 213-536-7 |