methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate
![methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate Structure](https://image.chemsrc.com/caspic/428/970-93-4.png)
methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate structure
|
Common Name | methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 970-93-4 | Molecular Weight | 294.30100 | |
| Density | 1.24g/cm3 | Boiling Point | 456ºC at 760 mmHg | |
| Molecular Formula | C18H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 456ºC at 760 mmHg |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.30100 |
| Flash Point | 231.9ºC |
| Exact Mass | 294.08900 |
| PSA | 52.60000 |
| LogP | 2.65960 |
| Index of Refraction | 1.598 |
| InChIKey | WOWOJPPNAHPPNE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1C#Cc1ccccc1C(=O)OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dimethyl 2,2'-ethynediyldibenzoate |
| Tolan-2,2'-dicarbonsaeure-dimethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate? |
| A: CAS number of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate is 970-93-4. |
| Q: What is the LogP of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate? |
| A: LogP of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate is 2.65960. |
| Q: What are the upstream materials of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate? |
| A: Related upstream materials(CAS) of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate: 33577-99-0;610-97-9;74-86-2;610-94-6;994-71-8;38399-13-2;186581-53-3;792-60-9. |
| Q: What is the English name of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate? |
| A: The English name of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate is methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate. |
| Q: What English synonyms does methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate have? |
| A: English synonyms of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate: Dimethyl 2,2'-ethynediyldibenzoate, Tolan-2,2'-dicarbonsaeure-dimethylester. |
| Q: What is the Chinese name of 970-93-4? |
| A: Chinese name of 970-93-4 is 970-93-4. |
| Q: What is the polar surface area (PSA) of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate? |
| A: Polar surface area (PSA) of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate is 52.60000. |
| Q: What is the molecular weight of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate? |
| A: Molecular weight of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate is 294.30100. |
| Q: What is the SMILES notation of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate? |
| A: SMILES notation of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate is COC(=O)c1ccccc1C#Cc1ccccc1C(=O)OC. |
| Q: What is the molecular formula of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate? |
| A: Molecular formula of methyl 2-[2-(2-methoxycarbonylphenyl)ethynyl]benzoate is C18H14O4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |