3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid
3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid structure
|
Common Name | 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid | ||
|---|---|---|---|---|
| CAS Number | 97073-66-0 | Molecular Weight | 417.43700 | |
| Density | N/A | Boiling Point | 467.2ºC at 760 mmHg | |
| Molecular Formula | C15H23N5O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 467.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C15H23N5O7S |
| Molecular Weight | 417.43700 |
| Flash Point | 236.3ºC |
| Exact Mass | 417.13200 |
| PSA | 224.93000 |
| LogP | 1.81330 |
| InChIKey | OKAHFCCFNVPTED-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)NC1=N.Cc1c(O)c(O)cc2[nH]cc(CCN)c12.O=S(=O)(O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-(2-aminoethyl... CAS#:97073-66-0 |
| Literature: Sinhababu, Achintya K.; Ghosh, Anil K.; Borchardt, Ronald T. Journal of Medicinal Chemistry, 1985 , vol. 28, # 9 p. 1273 - 1279 |
|
~%
3-(2-aminoethyl... CAS#:97073-66-0 |
| Literature: Sinhababu, Achintya K.; Ghosh, Anil K.; Borchardt, Ronald T. Journal of Medicinal Chemistry, 1985 , vol. 28, # 9 p. 1273 - 1279 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5,6-dihydroxy-4-fluorotryptamine creatinine sulfate |
| 5,6-Dhftc |
| 2-amino-1-methyl-5H-imidazol-4-one |
| 5,6-dihydroxy-4-methyltryptamine creatinine sulfate |
| 5,6-Dihydroxy-4-fluorotryptamine creatinine |
| 3-(2-aminoethyl)-4-fluoro-1H-indole-5,6-diol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid? |
| A: LogP of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid is 1.81330. |
| Q: What is the polar surface area (PSA) of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid? |
| A: Polar surface area (PSA) of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid is 224.93000. |
| Q: What is the InChIKey of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid? |
| A: InChIKey of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid is OKAHFCCFNVPTED-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid? |
| A: Molecular formula of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid is C15H23N5O7S. |
| Q: What English synonyms does 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid have? |
| A: English synonyms of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid: 5,6-dihydroxy-4-fluorotryptamine creatinine sulfate, 5,6-Dhftc, 2-amino-1-methyl-5H-imidazol-4-one, 5,6-dihydroxy-4-methyltryptamine creatinine sulfate, 5,6-Dihydroxy-4-fluorotryptamine creatinine, 3-(2-aminoethyl)-4-fluoro-1H-indole-5,6-diol. |
| Q: What is the Chinese name of 97073-66-0? |
| A: Chinese name of 97073-66-0 is 97073-66-0. |
| Q: What is the English name of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid? |
| A: The English name of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid is 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid. |
| Q: What is the boiling point of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid? |
| A: Boiling point of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid is 467.2ºC at 760 mmHg. |
| Q: What is the molecular weight of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid? |
| A: Molecular weight of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid is 417.43700. |
| Q: What is the SMILES notation of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid? |
| A: SMILES notation of 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid is CN1CC(=O)NC1=N.Cc1c(O)c(O)cc2[nH]cc(CCN)c12.O=S(=O)(O)O. |