3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid structure
|
Common Name | 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid | ||
|---|---|---|---|---|
| CAS Number | 97073-66-0 | Molecular Weight | 417.43700 | |
| Density | N/A | Boiling Point | 467.2ºC at 760 mmHg | |
| Molecular Formula | C15H23N5O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.3ºC | |
| Name | 3-(2-aminoethyl)-4-methyl-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 467.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C15H23N5O7S |
| Molecular Weight | 417.43700 |
| Flash Point | 236.3ºC |
| Exact Mass | 417.13200 |
| PSA | 224.93000 |
| LogP | 1.81330 |
| InChIKey | OKAHFCCFNVPTED-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)NC1=N.Cc1c(O)c(O)cc2[nH]cc(CCN)c12.O=S(=O)(O)O |
|
~%
3-(2-aminoethyl... CAS#:97073-66-0 |
| Literature: Sinhababu, Achintya K.; Ghosh, Anil K.; Borchardt, Ronald T. Journal of Medicinal Chemistry, 1985 , vol. 28, # 9 p. 1273 - 1279 |
|
~%
3-(2-aminoethyl... CAS#:97073-66-0 |
| Literature: Sinhababu, Achintya K.; Ghosh, Anil K.; Borchardt, Ronald T. Journal of Medicinal Chemistry, 1985 , vol. 28, # 9 p. 1273 - 1279 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5,6-dihydroxy-4-fluorotryptamine creatinine sulfate |
| 5,6-Dhftc |
| 2-amino-1-methyl-5H-imidazol-4-one |
| 5,6-dihydroxy-4-methyltryptamine creatinine sulfate |
| 5,6-Dihydroxy-4-fluorotryptamine creatinine |
| 3-(2-aminoethyl)-4-fluoro-1H-indole-5,6-diol |