N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride
![N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride Structure](https://image.chemsrc.com/caspic/168/97111-07-4.png)
N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride structure
|
Common Name | N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 97111-07-4 | Molecular Weight | 270.75500 | |
| Density | N/A | Boiling Point | 443ºC at 760mmHg | |
| Molecular Formula | C13H19ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 443ºC at 760mmHg |
|---|---|
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.75500 |
| Flash Point | 176.1ºC |
| Exact Mass | 270.11400 |
| PSA | 61.69000 |
| LogP | 3.66810 |
| InChIKey | ICEOFBNTFFKCED-UHFFFAOYSA-N |
| SMILES | CCNC(C)C(=O)c1ccc(NC(C)=O)cc1.Cl |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2925190090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~39%
N-[4-[2-(ethyla... CAS#:97111-07-4 |
| Literature: Laboratoire L. Lafon Patent: US4963570 A1, 1990 ; |
![N-[4-(2-chloropropanoyl)phenyl]acetamide structure](https://image.chemsrc.com/caspic/472/81112-08-5.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(4-(2-(Ethylamino)-1-oxopropyl)phenyl)acetamide monohydrochloride |
| LS-9530 |
| N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide hydrochloride |
| 1-(4-Acetylaminophenyl)-2-ethylaminopropanone hydrochloride |
| Acetamide,N-(4-(2-(ethylamino)-1-oxopropyl)phenyl)-,monohydrochloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride? |
| A: Molecular formula of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride is C13H19ClN2O2. |
| Q: What is the molecular weight of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride? |
| A: Molecular weight of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride is 270.75500. |
| Q: What is the polar surface area (PSA) of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride? |
| A: Polar surface area (PSA) of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride is 61.69000. |
| Q: What are the upstream materials of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride? |
| A: Related upstream materials(CAS) of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride: 81112-08-5;75-04-7. |
| Q: What is the boiling point of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride? |
| A: Boiling point of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride is 443ºC at 760mmHg. |
| Q: What English synonyms does N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride have? |
| A: English synonyms of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride: N-(4-(2-(Ethylamino)-1-oxopropyl)phenyl)acetamide monohydrochloride, LS-9530, N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide hydrochloride, 1-(4-Acetylaminophenyl)-2-ethylaminopropanone hydrochloride, Acetamide,N-(4-(2-(ethylamino)-1-oxopropyl)phenyl)-,monohydrochloride. |
| Q: What is the InChIKey of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride? |
| A: InChIKey of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride is ICEOFBNTFFKCED-UHFFFAOYSA-N. |
| Q: What is the English name of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride? |
| A: The English name of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride is N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride. |
| Q: What is the SMILES notation of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride? |
| A: SMILES notation of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride is CCNC(C)C(=O)c1ccc(NC(C)=O)cc1.Cl. |
| Q: What is the LogP of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride? |
| A: LogP of N-[4-[2-(ethylamino)propanoyl]phenyl]acetamide,hydrochloride is 3.66810. |