N-[4-(2-chloropropanoyl)phenyl]acetamide structure
|
Common Name | N-[4-(2-chloropropanoyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 81112-08-5 | Molecular Weight | 225.67100 | |
| Density | 1.237g/cm3 | Boiling Point | 429.9ºC at 760mmHg | |
| Molecular Formula | C11H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8ºC | |
| Name | N-[4-(2-chloropropanoyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 429.9ºC at 760mmHg |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67100 |
| Flash Point | 213.8ºC |
| Exact Mass | 225.05600 |
| PSA | 46.17000 |
| LogP | 2.52800 |
| Index of Refraction | 1.572 |
| InChIKey | FWBXOIYYUSIMST-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(=O)C(C)Cl)cc1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD06364488 |