cis-a-Hydroxy Tamoxifen
Modify Date: 2025-08-22 11:06:35
cis-a-Hydroxy Tamoxifen structure
|
Common Name | cis-a-Hydroxy Tamoxifen | ||
|---|---|---|---|---|
| CAS Number | 97170-41-7 | Molecular Weight | 387.51400 | |
| Density | 1.094g/cm3 | Boiling Point | 533.8ºC at 760mmHg | |
| Molecular Formula | C26H29NO2 | Melting Point | 112-114ºC | |
| MSDS | N/A | Flash Point | 276.6ºC | |
| Name | cis-a-Hydroxy Tamoxifen |
|---|---|
| Synonym | More Synonyms |
| Density | 1.094g/cm3 |
|---|---|
| Boiling Point | 533.8ºC at 760mmHg |
| Melting Point | 112-114ºC |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.51400 |
| Flash Point | 276.6ºC |
| Exact Mass | 387.22000 |
| PSA | 32.70000 |
| LogP | 4.96690 |
| Index of Refraction | 1.595 |
| InChIKey | BPHFBQJMFWCHGH-OCEACIFDSA-N |
| SMILES | CC(O)C(=C(c1ccccc1)c1ccc(OCCN(C)C)cc1)c1ccccc1 |
| HS Code | 2922509090 |
|---|
|
~%
cis-a-Hydroxy T... CAS#:97170-41-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 28, # 10 p. 1491 - 1497 |
|
~%
cis-a-Hydroxy T... CAS#:97170-41-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 28, # 10 p. 1491 - 1497 |
|
~%
Detail
|
| Literature: Journal of Medicinal Chemistry, , vol. 28, # 10 p. 1491 - 1497 |
![(E,Z)-1-Bromo-2-[4-[2-(dimethylamino)ethoxy]phenyl]-1,2-diphenylethene structure](https://image.chemsrc.com/caspic/349/19118-19-5.png)
![2-[4-(1,2-diphenylethenyl)phenoxy]-N,N-dimethylethanamine structure](https://image.chemsrc.com/caspic/397/19957-51-8.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (Z) 1-methoxy-2-cyclohexenyl |
| cis-(Z)-1-<4-<2-(dimethylamino)ethoxy>phenyl>-1,2-diphenyl-1-buten-3-ol |
| (E) 1-methoxy-2-cyclohexenyl |
| Oxonium,2-cyclohexen-1-ylidenemethyl |
| (Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-1,2-diphenyl-1-buten-3-ol |
| cis-(Z)-4-[4-(2-dimethylamino-ethoxy)-phenyl]-3,4-diphenyl-but-3-en-2-ol |