diethylammonium (R)-2-(4-chloro-2-methylphenoxy)propionate structure
|
Common Name | diethylammonium (R)-2-(4-chloro-2-methylphenoxy)propionate | ||
|---|---|---|---|---|
| CAS Number | 97233-27-7 | Molecular Weight | 287.782 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-Ethylethanaminium (2R)-2-(4-chloro-2-methylphenoxy)propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H22ClNO3 |
|---|---|
| Molecular Weight | 287.782 |
| Exact Mass | 287.128815 |
| InChIKey | YWWMOSBBXLVHSK-OGFXRTJISA-N |
| SMILES | CCNCC.Cc1cc(Cl)ccc1OC(C)C(=O)O |
| Propanoic acid, 2-(4-chloro-2-methylphenoxy)-, (2R)-, compd. with N-ethylethanamine (1:1) |
| Propanoic acid, 2-(4-chloro-2-methylphenoxy)-, compd. with N-ethylethanamine (1:1), (2R)- |
| EINECS 306-402-5 |
| EINECS 306-418-2 |
| N-Ethylethanaminium (2R)-2-(4-chloro-2-methylphenoxy)propanoate |