Benzyl D-(-)-Mandelate structure
|
Common Name | Benzyl D-(-)-Mandelate | ||
|---|---|---|---|---|
| CAS Number | 97415-09-3 | Molecular Weight | 242.270 | |
| Density | 1.204 | Boiling Point | 387 ºC | |
| Molecular Formula | C15H14O3 | Melting Point | 104-107ºC | |
| MSDS | USA | Flash Point | 163 ºC | |
| Name | benzyl (2R)-2-hydroxy-2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204 |
|---|---|
| Boiling Point | 387 ºC |
| Melting Point | 104-107ºC |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.270 |
| Flash Point | 163 ºC |
| Exact Mass | 242.094299 |
| PSA | 46.53000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | JFKWZVQEMSKSBU-CQSZACIVSA-N |
| SMILES | O=C(OCc1ccccc1)C(O)c1ccccc1 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Konoike, T. Araki, Y.
J. Org. Chem. 59 , 7849, (1994)
|
| Benzeneacetic acid, α-hydroxy-, phenylmethyl ester, (αR)- |
| Benzyl (2R)-hydroxy(phenyl)acetate |
| benzyl L-mandelate |
| MFCD00674031 |
| benzyl (2R)-hydroxy(phenyl)ethanoate |
| benzeneacetic acid, a-hydroxy-, phenylmethyl ester, (aR)- |
| benzyl mandelate |
| D-(-)-MANDELIC ACID BENZYL ESTER |
| (-)-Mandelic acid benzyl ester |
| Benzyl D-(-)-Mandelate |