2-Nitro-5-phenylpyridine structure
|
Common Name | 2-Nitro-5-phenylpyridine | ||
|---|---|---|---|---|
| CAS Number | 97608-11-2 | Molecular Weight | 200.19300 | |
| Density | 1.252g/cm3 | Boiling Point | 383.3ºC at 760mmHg | |
| Molecular Formula | C11H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.6ºC | |
| Name | 2-Nitro-5-phenylpyridine |
|---|
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 383.3ºC at 760mmHg |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.19300 |
| Flash Point | 185.6ºC |
| Exact Mass | 200.05900 |
| PSA | 58.71000 |
| LogP | 3.18000 |
| Index of Refraction | 1.611 |
| InChIKey | YPQXIVFXNVCVFI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-c2ccccc2)cn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |