ethyl 2-acetyloxy-2-(benzhydrylideneamino)acetate structure
|
Common Name | ethyl 2-acetyloxy-2-(benzhydrylideneamino)acetate | ||
|---|---|---|---|---|
| CAS Number | 97611-55-7 | Molecular Weight | 325.35800 | |
| Density | 1.11g/cm3 | Boiling Point | 421ºC at 760 mmHg | |
| Molecular Formula | C19H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.6ºC | |
| Name | ethyl 2-acetyloxy-2-(benzhydrylideneamino)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 421ºC at 760 mmHg |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.35800 |
| Flash Point | 159.6ºC |
| Exact Mass | 325.13100 |
| PSA | 64.96000 |
| LogP | 2.97630 |
| Index of Refraction | 1.544 |
| InChIKey | FOCYLNDNLMPUTK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(N=C(c1ccccc1)c1ccccc1)OC(C)=O |
| HS Code | 2925290090 |
|---|
|
~71%
ethyl 2-acetylo... CAS#:97611-55-7 |
| Literature: O'Donnell, Martin J.; Bennett, William D.; Polt, Robin L. Tetrahedron Letters, 1985 , vol. 26, # 6 p. 695 - 698 |
|
~64%
ethyl 2-acetylo... CAS#:97611-55-7 |
| Literature: Baba, Daisuke; Fuchigami, Toshio Tetrahedron Letters, 2003 , vol. 44, # 15 p. 3133 - 3136 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 2-acetoxy-2-diphenylmethyleneaminoacetate |
| 2-ACETOXY-N-(DIPHENYLMETHYLENE)GLYCINE ETHYL ESTER |