ethyl 2-acetyloxy-2,2-diphenyl-acetate structure
|
Common Name | ethyl 2-acetyloxy-2,2-diphenyl-acetate | ||
|---|---|---|---|---|
| CAS Number | 4406-92-2 | Molecular Weight | 298.33300 | |
| Density | 1.151g/cm3 | Boiling Point | 413.8ºC at 760 mmHg | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204ºC | |
| Name | ethyl 2-acetyloxy-2,2-diphenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 413.8ºC at 760 mmHg |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.33300 |
| Flash Point | 204ºC |
| Exact Mass | 298.12100 |
| PSA | 52.60000 |
| LogP | 3.05640 |
| Index of Refraction | 1.544 |
| InChIKey | YQGHSKFXAATHHI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(OC(C)=O)(c1ccccc1)c1ccccc1 |
| HS Code | 2918990090 |
|---|
|
~%
ethyl 2-acetylo... CAS#:4406-92-2 |
| Literature: Bickel Chemische Berichte, 1889 , vol. 22, p. 1537 |
|
~%
ethyl 2-acetylo... CAS#:4406-92-2 |
| Literature: Bickel Chemische Berichte, 1889 , vol. 22, p. 1537 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetyl-benzilsaeure-aethylester |
| O-Acetyl-benzilsaeure-aethylester |
| Acetoxy-diphenyl-essigsaeure-aethylester |
| acetoxy-diphenyl-acetic acid ethyl ester |