N-(2,6-dimethylphenyl)-4-methoxybenzamide structure
|
Common Name | N-(2,6-dimethylphenyl)-4-methoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 97769-01-2 | Molecular Weight | 255.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,6-dimethylphenyl)-4-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17NO2 |
|---|---|
| Molecular Weight | 255.31200 |
| Exact Mass | 255.12600 |
| PSA | 38.33000 |
| LogP | 3.63730 |
| InChIKey | GPQWVHPHWNPAGJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Nc2c(C)cccc2C)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(2,6-dimethyl... CAS#:97769-01-2 |
| Literature: Clark; McMillian Journal of Pharmaceutical Sciences, 1990 , vol. 79, # 3 p. 220 - 222 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Methoxy-benzoesaeure-<2,6-dimethyl-anilid> |
| 2,6-dimethyl-N-(4-methoxybenzoyl)aniline |
| N-(2,6-DIMETHYLPHENYL)-4-METHOXY-BENZAMIDE |