Ractopamine structure
|
Common Name | Ractopamine | ||
|---|---|---|---|---|
| CAS Number | 97825-25-7 | Molecular Weight | 301.380 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 520.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H23NO3 | Melting Point | 165-167ºC | |
| MSDS | N/A | Flash Point | 165.3±20.7 °C | |
| Name | 4-[3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 520.5±50.0 °C at 760 mmHg |
| Melting Point | 165-167ºC |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.380 |
| Flash Point | 165.3±20.7 °C |
| Exact Mass | 301.167786 |
| PSA | 72.72000 |
| LogP | 1.65 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | YJQZYXCXBBCEAQ-UHFFFAOYSA-N |
| SMILES | CC(CCc1ccc(O)cc1)NCC(O)c1ccc(O)cc1 |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R20/22;R43 |
| Safety Phrases | S24-S26-S37 |
| HS Code | 2922502000 |
|
~%
Ractopamine CAS#:97825-25-7 |
| Literature: US2009/143480 A1, ; Page/Page column 7 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922111000 |
|---|---|
| Summary | 2922111000 4-(1-hydroxy-2-((4-(4-hydroxyphenyl)butan-2-yl)amino)ethyl)phenol。supervision conditions:89(articles on the list of prohibited export goods,articles on the list of prohibited import goods)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
| MFCD00870322 |
| Ractopamine HCl |
| Ractopamina [Spanish] |
| Ractopamine [INN] |
| Ractopaminum [Latin] |
| RR,SS,RS,SR-ractopamine |
| RACTOPAMINE |
| 1-(4-hydroxyphenyl)-2-[3-(4-hydroxyphenyl)-1-methylpropylamino]ethanol |