[4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate
![[4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate Structure](https://image.chemsrc.com/caspic/388/97845-75-5.png)
[4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate structure
|
Common Name | [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate | ||
|---|---|---|---|---|
| CAS Number | 97845-75-5 | Molecular Weight | 309.27800 | |
| Density | 1.58g/cm3 | Boiling Point | 622.9ºC at 760 mmHg | |
| Molecular Formula | C12H15N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.5ºC | |
Summary: Chinese name:暂无, English name:[4-(2-Amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate, CAS number:97845-75-5, molecular formula:C12H15N5O5, molecular weight:309.27800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 622.9ºC at 760 mmHg |
| Molecular Formula | C12H15N5O5 |
| Molecular Weight | 309.27800 |
| Flash Point | 330.5ºC |
| Exact Mass | 309.10700 |
| PSA | 143.18000 |
| LogP | 0.66830 |
| Index of Refraction | 1.671 |
| InChIKey | YNAMULWOQHJWTL-UHFFFAOYSA-N |
| SMILES | Nc1nc2c(ncn2CCC(COC=O)COC=O)c(=O)[nH]1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![6-chloro-9-[2-(2,2-dimethyl-1,3-dioxan-5-yl)ethyl]purin-2-amine structure](https://image.chemsrc.com/caspic/150/97845-59-5.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6H-Purin-6-one,2-amino-9-[4-(formyloxy)-3-[(formyloxy)methyl]butyl]-1,9-dihydro |
| 9-<4-(formyloxy)-3-<(formyloxy)methyl>but-1-yl>guanine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate? |
| A: LogP of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate is 0.66830. |
| Q: What is the polar surface area (PSA) of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate? |
| A: Polar surface area (PSA) of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate is 143.18000. |
| Q: What is the CAS number of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate? |
| A: CAS number of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate is 97845-75-5. |
| Q: What is the English name of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate? |
| A: The English name of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate is [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate. |
| Q: What is the molecular weight of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate? |
| A: Molecular weight of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate is 309.27800. |
| Q: What is the SMILES notation of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate? |
| A: SMILES notation of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate is Nc1nc2c(ncn2CCC(COC=O)COC=O)c(=O)[nH]1. |
| Q: What is the Chinese name of 97845-75-5? |
| A: Chinese name of 97845-75-5 is 97845-75-5. |
| Q: What is the InChIKey of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate? |
| A: InChIKey of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate is YNAMULWOQHJWTL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate? |
| A: Molecular formula of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate is C12H15N5O5. |
| Q: What English synonyms does [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate have? |
| A: English synonyms of [4-(2-amino-6-oxo-3H-purin-9-yl)-2-(formyloxymethyl)butyl] formate: 6H-Purin-6-one,2-amino-9-[4-(formyloxy)-3-[(formyloxy)methyl]butyl]-1,9-dihydro, 9-<4-(formyloxy)-3-but-1-yl>guanine. |