bis(5-tert-butyl-2-methoxyphenyl)methanone structure
|
Common Name | bis(5-tert-butyl-2-methoxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 98085-85-9 | Molecular Weight | 354.48300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(5-tert-butyl-2-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H30O3 |
|---|---|
| Molecular Weight | 354.48300 |
| Exact Mass | 354.21900 |
| PSA | 35.53000 |
| LogP | 5.52980 |
| InChIKey | MUPFANHBVBKOMD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C)(C)C)cc1C(=O)c1cc(C(C)(C)C)ccc1OC |
|
~60%
bis(5-tert-buty... CAS#:98085-85-9 |
| Literature: Verkerk, Udo; Fujita, Megumi; Dzwiniel, Trevor L.; McDonald, Robert; Stryker, Jeffrey M. Journal of the American Chemical Society, 2002 , vol. 124, # 34 p. 9988 - 9989 |
|
~%
bis(5-tert-buty... CAS#:98085-85-9 |
| Literature: Verkerk, Udo; Fujita, Megumi; Dzwiniel, Trevor L.; McDonald, Robert; Stryker, Jeffrey M. Journal of the American Chemical Society, 2002 , vol. 124, # 34 p. 9988 - 9989 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Methanone,bis[5-(1,1-dimethylethyl)-2-methoxyphenyl] |