14(S),15(R)-Epoxy-(5Z,8Z,11Z)-eicosatrienoic acid
Modify Date: 2025-08-25 16:25:48
14(S),15(R)-Epoxy-(5Z,8Z,11Z)-eicosatrienoic acid structure
|
Common Name | 14(S),15(R)-Epoxy-(5Z,8Z,11Z)-eicosatrienoic acid | ||
|---|---|---|---|---|
| CAS Number | 98103-48-1 | Molecular Weight | 320.466 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 464.5±33.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.7±18.9 °C | |
| Name | 14(S),15(R)-Epoxy-(5Z,8Z,11Z)-eicosatrienoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 464.5±33.0 °C at 760 mmHg |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.466 |
| Flash Point | 155.7±18.9 °C |
| Exact Mass | 320.235138 |
| LogP | 5.86 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | JBSCUHKPLGKXKH-FQOFBZQNSA-N |
| SMILES | CCCCCC1OC1CC=CCC=CCC=CCCCC(=O)O |
| Hazard Codes | F;Xi |
|---|---|
| Risk Phrases | R11;R36/37/38 |
| Safety Phrases | S16;S26;S36 |
| RIDADR | UN 1170 3/PG 2 |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
Total 2, Current Page 1 of 1
1
| (14R,15S)-EET |
| (5Z,8Z,11Z)-13-[(2R,3S)-3-Pentyl-2-oxiranyl]-5,8,11-tridecatrienoic acid |
| MFCD00132917 |