2-[(1-Acetyl-2-oxopropyl)thio]-N-cyclohexyl-1H-benzimidazole-1-carboxamide structure
|
Common Name | 2-[(1-Acetyl-2-oxopropyl)thio]-N-cyclohexyl-1H-benzimidazole-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 98183-15-4 | Molecular Weight | 373.46900 | |
| Density | 1.34 | Boiling Point | N/A | |
| Molecular Formula | C19H23N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-cyclohexyl-2-(2,4-dioxopentan-3-ylsulfanyl)benzimidazole-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34 |
|---|---|
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.46900 |
| Exact Mass | 373.14600 |
| PSA | 106.36000 |
| LogP | 3.95630 |
| Index of Refraction | 1.66 |
| InChIKey | PYNJDHQMZUHVIC-UHFFFAOYSA-N |
| SMILES | CC(=O)C(Sc1nc2ccccc2n1C(=O)NC1CCCCC1)C(C)=O |
|
~99%
2-[(1-Acetyl-2-... CAS#:98183-15-4 |
| Literature: Martin, Dieter; Tittelbach, Franz Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1007 - 1014 |
|
~%
2-[(1-Acetyl-2-... CAS#:98183-15-4 |
| Literature: Martin, Dieter; Tittelbach, Franz Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1007 - 1014 |
| 2-[(1-acetyl-2-oxopropyl)thio]-n-cyclohexyl-1h-benzo[d]imidazole-1-carboxamide |
| 2-[(1-Acetyl-2-oxopropyl)thio]-N-cyclohexyl-1H-benzimidazole-1-carboxamide |