1-(2,3-dihydro-1-benzofuran-7-yl)piperazine
1-(2,3-dihydro-1-benzofuran-7-yl)piperazine structure
|
Common Name | 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 98205-73-3 | Molecular Weight | 204.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16N2O |
|---|---|
| Molecular Weight | 204.26800 |
| Exact Mass | 204.12600 |
| PSA | 24.50000 |
| LogP | 1.42490 |
| InChIKey | LYYMQFBSALARPF-UHFFFAOYSA-N |
| SMILES | c1cc2c(c(N3CCNCC3)c1)OCC2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![2,3-DIHYDROBENZO[B]FURAN-7-YLAMINE structure](https://image.chemsrc.com/caspic/127/13414-56-7.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(2,3-dihydro-1-benzofuran-7-yl)piperazine |
| Piperazine,1-(2,3-dihydro-7-benzofuranyl) |
| 1-(2,3-dihydro-benzofuran-7-yl)-piperazine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine? |
| A: CAS number of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine is 98205-73-3. |
| Q: What is the molecular formula of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine? |
| A: Molecular formula of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine is C12H16N2O. |
| Q: What is the SMILES notation of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine? |
| A: SMILES notation of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine is c1cc2c(c(N3CCNCC3)c1)OCC2. |
| Q: What is the LogP of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine? |
| A: LogP of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine is 1.42490. |
| Q: What are the upstream materials of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine? |
| A: Related upstream materials(CAS) of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine: 110-85-0;206347-30-0;821-48-7;13414-56-7;846037-41-0;496-16-2;35700-40-4;608-33-3;206347-32-2. |
| Q: What English synonyms does 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine have? |
| A: English synonyms of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine: N-(2,3-dihydro-1-benzofuran-7-yl)piperazine, Piperazine,1-(2,3-dihydro-7-benzofuranyl), 1-(2,3-dihydro-benzofuran-7-yl)-piperazine. |
| Q: What is the Chinese name of 98205-73-3? |
| A: Chinese name of 98205-73-3 is 98205-73-3. |
| Q: What is the InChIKey of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine? |
| A: InChIKey of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine is LYYMQFBSALARPF-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine? |
| A: The English name of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine is 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine. |
| Q: What is the polar surface area (PSA) of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine? |
| A: Polar surface area (PSA) of 1-(2,3-dihydro-1-benzofuran-7-yl)piperazine is 24.50000. |