Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate structure
|
Common Name | Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 98349-24-7 | Molecular Weight | 246.183 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 283.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H9F3O3 | Melting Point | 66-68ºC | |
| MSDS | N/A | Flash Point | 121.2±20.8 °C | |
| Name | Ethyl 2,4,5-trifluorobenzoylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 283.1±35.0 °C at 760 mmHg |
| Melting Point | 66-68ºC |
| Molecular Formula | C11H9F3O3 |
| Molecular Weight | 246.183 |
| Flash Point | 121.2±20.8 °C |
| Exact Mass | 246.050385 |
| PSA | 43.37000 |
| LogP | 1.67 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.469 |
| InChIKey | OTCJYVJORKMTHX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cc(F)c(F)cc1F |
| Hazard Codes | C: Corrosive;Xi: Irritant;T: Toxic; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN2811 6. |
| HS Code | 2916399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzenepropanoic acid, 2,4,5-trifluoro-β-oxo-, ethyl ester |
| MFCD00792431 |
| Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate |