(4-cyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene)cyanamide structure
|
Common Name | (4-cyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene)cyanamide | ||
|---|---|---|---|---|
| CAS Number | 98507-06-3 | Molecular Weight | 184.19700 | |
| Density | 1.1g/cm3 | Boiling Point | 275ºC at 760 mmHg | |
| Molecular Formula | C10H8N4 | Melting Point | 191-194ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 120.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (4-cyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene)cyanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 275ºC at 760 mmHg |
| Melting Point | 191-194ºC(lit.) |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.19700 |
| Flash Point | 120.1ºC |
| Exact Mass | 184.07500 |
| PSA | 72.30000 |
| LogP | 1.73676 |
| Index of Refraction | 1.583 |
| InChIKey | GJCNOUWCQVLIEI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC#N)C(C)=CC1=NC#N |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2926909090 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Six new crystalline clathrates of cyclotricatechylene (CTC) including two donor-acceptor complexes. Loughrey JJ, et al.
Supramol. Chem. 24(1) , 2-13, (2012)
|
| N,N'-Dicyano-2,5-dimethylbenzoquinonediimine |
| HMS1787A10 |
| N,N'-Dicyano-2,5-dimethyl-1,4-benzoquinonediimine |
| MFCD00192076 |