1-(4-methoxyphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid structure
|
Common Name | 1-(4-methoxyphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 98534-83-9 | Molecular Weight | 286.20700 | |
| Density | 1.44g/cm3 | Boiling Point | 403.1ºC at 760 mmHg | |
| Molecular Formula | C12H9F3N2O3 | Melting Point | 163-167ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 197.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(4-methoxyphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 403.1ºC at 760 mmHg |
| Melting Point | 163-167ºC(lit.) |
| Molecular Formula | C12H9F3N2O3 |
| Molecular Weight | 286.20700 |
| Flash Point | 197.6ºC |
| Exact Mass | 286.05700 |
| PSA | 64.35000 |
| LogP | 2.59790 |
| Index of Refraction | 1.545 |
| InChIKey | KABDVMIQQQDCGP-UHFFFAOYSA-N |
| SMILES | COc1ccc(-n2ncc(C(=O)O)c2C(F)(F)F)cc1 |
|
~%
1-(4-methoxyphe... CAS#:98534-83-9 |
| Literature: Beck, James R.; Wright, Fred L. Journal of Heterocyclic Chemistry, 1987 , vol. 24, p. 739 - 740 |
|
~%
1-(4-methoxyphe... CAS#:98534-83-9 |
| Literature: Beck, James R.; Wright, Fred L. Journal of Heterocyclic Chemistry, 1987 , vol. 24, p. 739 - 740 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Binding affinity to Pseudomonas aeruginosa MurB assessed as change in melting tempera...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5041873
|
| I04-8588 |
| 1-(4-methoxyphenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid |
| MFCD03934806 |