3-acetyl-4,5-dimethyl-5-hydroxy-1,5-dihydro-2h-pyrrol-2-one structure
|
Common Name | 3-acetyl-4,5-dimethyl-5-hydroxy-1,5-dihydro-2h-pyrrol-2-one | ||
|---|---|---|---|---|
| CAS Number | 98593-79-4 | Molecular Weight | 169.17800 | |
| Density | 1.233 g/cm3 | Boiling Point | 444.2ºC at 760 mmHg | |
| Molecular Formula | C8H11NO3 | Melting Point | 172-174ºC | |
| MSDS | N/A | Flash Point | 222.4ºC | |
| Name | 3-acetyl-4,5-dimethyl-5-hydroxy-1,5-dihydro-2h-pyrrol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233 g/cm3 |
|---|---|
| Boiling Point | 444.2ºC at 760 mmHg |
| Melting Point | 172-174ºC |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.17800 |
| Flash Point | 222.4ºC |
| Exact Mass | 169.07400 |
| PSA | 66.40000 |
| LogP | 0.05900 |
| Index of Refraction | 1.519 |
| InChIKey | DHZJIJWGYQXKFT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C)C(C)(O)NC1=O |
| Safety Phrases | S24/25 |
|---|---|
| HS Code | 2933990090 |
|
~%
3-acetyl-4,5-di... CAS#:98593-79-4 |
| Literature: Journal of the American Chemical Society, , vol. 81, p. 4355 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Induction of neurite outgrowth in SH-SY5Y cells, measured by the difference in the pe...
Source: ChEMBL
Target: SH-SY5Y
External Id: CHEMBL805166
|
| 3-acetyl-5-hydroxy-4,5-dimethyl-1,5-dihydro-pyrrol-2-one |
| 2H-Pyrrol-2-one 3-acetyl-1,5-dihydro-5-hydroxy-4,5-dimethyl |
| 3-ACETYL-5-HYDROXY-4,5-DIMETHYL-1,5-DIHYDRO-2H-PYRROL-2-ONE |
| MT-21,NEGATIVE CONTROL |
| 3-ACETYL-4,5-DIMETHYL-5-HYDROXY-3-PYRROLIN-2-ONE |