OMTP
Modify Date: 2025-08-31 19:09:11
OMTP structure
|
Common Name | OMTP | ||
|---|---|---|---|---|
| CAS Number | 98809-58-6 | Molecular Weight | 279.336 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 460.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.1±31.5 °C | |
| Name | 4-Methyl-2-(1-(2-methylallyl)-1H-benzo[d][1,2,3]triazol-2(3H)-yl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 460.1±55.0 °C at 760 mmHg |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 279.336 |
| Flash Point | 232.1±31.5 °C |
| Exact Mass | 279.137177 |
| PSA | 45.88000 |
| LogP | 5.87 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | GAXSBDZDZCJXCG-UHFFFAOYSA-N |
| SMILES | C=C(C)CN1c2ccccc2NN1c1cc(C)ccc1O |
| HS Code | 2933990090 |
|---|
|
~40%
OMTP CAS#:98809-58-6 |
| Literature: US2009/270632 A1, ; Page/Page column 2 ; |
|
~86%
OMTP CAS#:98809-58-6 |
| Literature: US2009/270632 A1, ; Page/Page column 2; 3 ; |
|
~%
OMTP CAS#:98809-58-6 |
| Literature: WO2012/55063 A1, ; Page/Page column 19 ; |
![[(2-methyl-2-propenyl)oxy]phenyl]- structure](https://image.chemsrc.com/caspic/449/2170-60-7.png)
CAS#:155633-54-8| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2H-1,2,3-Benzotriazol-2-yl)-4-methyl-6-(2-methyl-2-propen-1-yl)phenol |
| 2-(2H-Benzotriazol-2-yl)-4-methyl-6-(2-methyl-2-propen-1-yl)phenol |
| T56 BNNNJ CR BQ E1 C1Y1&U1 |
| 2-Benzotriazol-2-yl-4-methyl-6-(2-methylallyl)phenol |
| 2-(2H-Benzotriazol-2-yl)-4-methyl-6-(2-methylprop-2-en-1-yl)phenol |
| 4-methyl-2-[3-(2-methylprop-2-enyl)-1H-benzotriazol-2-yl]phenol |
| OMTP |