3-Feruloyl-1-Sinapoyl sucrose structure
|
Common Name | 3-Feruloyl-1-Sinapoyl sucrose | ||
|---|---|---|---|---|
| CAS Number | 98942-06-4 | Molecular Weight | 724.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H40O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-Feruloyl-1-Sinapoyl sucrose3-Feruloyl-1-Sinapoyl sucrose (compound 1) is a glycoside isolated from the aerial parts of Polygala chamaebuxus[1]. |
| Name | 3-Feruloyl-1-Sinapoyl sucrose |
|---|
| Description | 3-Feruloyl-1-Sinapoyl sucrose (compound 1) is a glycoside isolated from the aerial parts of Polygala chamaebuxus[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Matthias Hamburger, et al. Hydroxycinnamic acid esters from Polygala chamaebuxus. |
| Molecular Formula | C33H40O18 |
|---|---|
| Molecular Weight | 724.67 |
| InChIKey | LHGNBKKPEPCPCT-CHQRVIDVSA-N |
| SMILES | COc1cc(C=CC(=O)OC2C(O)C(CO)OC2(COC(=O)C=Cc2cc(OC)c(O)c(OC)c2)OC2OC(CO)C(O)C(O)C2O)ccc1O |
| Hazard Codes | Xi |
|---|