D-Trehalose structure
|
Common Name | D-Trehalose | ||
|---|---|---|---|---|
| CAS Number | 99-20-7 | Molecular Weight | 342.297 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 675.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C12H22O11 | Melting Point | 203 °C | |
| MSDS | Chinese USA | Flash Point | 362.3±31.5 °C | |
Use of D-TrehaloseD-(+)-Trehalose, isolated from Saccharomyces cerevisiae, can be used as a food ingredient and pharmaceutical excipient. |
| Name | α,α-trehalose |
|---|---|
| Synonym | More Synonyms |
| Description | D-(+)-Trehalose, isolated from Saccharomyces cerevisiae, can be used as a food ingredient and pharmaceutical excipient. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 675.4±55.0 °C at 760 mmHg |
| Melting Point | 203 °C |
| Molecular Formula | C12H22O11 |
| Molecular Weight | 342.297 |
| Flash Point | 362.3±31.5 °C |
| Exact Mass | 342.116211 |
| PSA | 189.53000 |
| LogP | -3.30 |
| Vapour Pressure | 0.0±4.7 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | HDTRYLNUVZCQOY-LIZSDCNHSA-N |
| SMILES | OCC1OC(OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R38 |
| Safety Phrases | S37/39-S26 |
| HS Code | 2940000000 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| a-D-glucopyranosyl a-D-glucopyranoside |
| alpha,alpha-trehalose |
| Trehalose |
| MFCD00006628 |
| α-D-Glucopyranosyl α-D-glucopyranoside |
| (a-D-Glucosido)-a-D-glucoside |
| α-D-Glucopyranose, O-α-D-glucopyranosyl |
| a-D-Glucopyranosyl-a-D-glucopyranoside |
| α-D-Glucopyranoside, α-D-glucopyranosyl |
| a,a-Trehalose |
| α-D-Glucopyranoside, a-D-glucopyranosyl (9CI) |
| EINECS 202-739-6 |
| a-D-glucopyranoside, a-D-glucopyranosyl |
| D-(+)-trehalose |
| (2R,3R,4S,5S,6R,2'R,3'R,4'S,5'S,6'R)-2,2'-Oxybis[6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol] |
| (2R,3R,4S,5S,6R,2'R,3'R,4'S,5'S,6'R)-2,2'-Oxybis[6-(hydroxyméthyl)tétrahydro-2H-pyran-3,4,5-triol] |
| α,α-Trehalose |
| D-(+)-Trehalose Anhydrous |
| Trehalose (8CI) |