Bismuth subgallate structure
|
Common Name | Bismuth subgallate | ||
|---|---|---|---|---|
| CAS Number | 99-26-3 | Molecular Weight | 394.091 | |
| Density | N/A | Boiling Point | 501.1ºC at 760mmHg | |
| Molecular Formula | C7H5BiO6 | Melting Point | 223 °C (dec.)(lit.) | |
| MSDS | N/A | Flash Point | 270.9ºC | |
Use of Bismuth subgallateBismuth subgallate, a hemostatic agent, acts on coagulation factor XII (Hageman factor), leading to the activation of the coagulation cascade and improving early formation of a fibrin clot[1][2]. |
| Name | bismuth subgallate |
|---|---|
| Synonym | More Synonyms |
| Description | Bismuth subgallate, a hemostatic agent, acts on coagulation factor XII (Hageman factor), leading to the activation of the coagulation cascade and improving early formation of a fibrin clot[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 501.1ºC at 760mmHg |
|---|---|
| Melting Point | 223 °C (dec.)(lit.) |
| Molecular Formula | C7H5BiO6 |
| Molecular Weight | 394.091 |
| Flash Point | 270.9ºC |
| Exact Mass | 393.989014 |
| PSA | 96.22000 |
| LogP | 0.59980 |
| InChIKey | XXCBNHDMGIZPQF-UHFFFAOYSA-L |
| SMILES | O.O=C(O)c1cc(O)c2c(c1)O[Bi]O2 |
| Stability | Stable, but may be light sensitive. |
| Risk Phrases | R20/21/22 |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| bismuth subgalate |
| EINECS 202-742-2 |
| 2,7-Dihydroxy-1,3,2-benzodioxabismole-5-carboxylic acid |
| MFCD00044980 |
| bismuthgattatlba-sic |
| BISMUTHSUBGALLATE,USP |
| Bismuth subgallate |
| BISMUTH GALLATE,BASIC |
| gallic acid bismuth basic salt |
| Bismuthsubgarate |
| basicbismuthgallate |
| Dermatol |
| BISMUTH GALLATE |
| Bismuth gallate, basic |
| Bismuthoxygallate |