2,6-bis[(4-methylphenyl)sulfanylmethyl]pyridine structure
|
Common Name | 2,6-bis[(4-methylphenyl)sulfanylmethyl]pyridine | ||
|---|---|---|---|---|
| CAS Number | 99007-95-1 | Molecular Weight | 351.52800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21NS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-bis[(4-methylphenyl)sulfanylmethyl]pyridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H21NS2 |
|---|---|
| Molecular Weight | 351.52800 |
| Exact Mass | 351.11200 |
| PSA | 63.49000 |
| LogP | 6.28300 |
| InChIKey | NMNXITQLFAPAJJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(SCc2cccc(CSc3ccc(C)cc3)n2)cc1 |
|
~%
2,6-bis[(4-meth... CAS#:99007-95-1 |
| Literature: Parker, David; Lehn, Jean-Marie; Rimmer, John Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1985 , p. 1517 - 1522 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Pyridine,2,6-bis[[(4-methylphenyl)thio]methyl] |
| 2,6-bis(p-tolylthiomethyl)pyridine |