1,4-Dichloro-6,7-dimethoxyphthalazine structure
|
Common Name | 1,4-Dichloro-6,7-dimethoxyphthalazine | ||
|---|---|---|---|---|
| CAS Number | 99161-51-0 | Molecular Weight | 259.08900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-Dichloro-6,7-dimethoxyphthalazine |
|---|
| Molecular Formula | C10H8Cl2N2O2 |
|---|---|
| Molecular Weight | 259.08900 |
| Exact Mass | 257.99600 |
| PSA | 44.24000 |
| LogP | 2.95380 |
| InChIKey | FZQVLUDQZVSOHF-UHFFFAOYSA-N |
| SMILES | COc1cc2c(Cl)nnc(Cl)c2cc1OC |
| HS Code | 2933990090 |
|---|
|
~%
1,4-Dichloro-6,... CAS#:99161-51-0 |
| Literature: Nomoto; Obase; Takai; Teranishi; Nakamura; Kubo Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 8 p. 2179 - 2183 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |