2-Methyl-4-aMino-6-nitroquinoline structure
|
Common Name | 2-Methyl-4-aMino-6-nitroquinoline | ||
|---|---|---|---|---|
| CAS Number | 99185-71-4 | Molecular Weight | 203.19700 | |
| Density | 1.381g/cm3 | Boiling Point | 420.51ºC at 760 mmHg | |
| Molecular Formula | C10H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.117ºC | |
| Name | 2-methyl-6-nitroquinolin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.381g/cm3 |
|---|---|
| Boiling Point | 420.51ºC at 760 mmHg |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.19700 |
| Flash Point | 208.117ºC |
| Exact Mass | 203.06900 |
| PSA | 84.73000 |
| LogP | 3.13800 |
| Index of Refraction | 1.715 |
| InChIKey | BJGZNGVTLAUJID-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)c2cc([N+](=O)[O-])ccc2n1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-METHYL-4-AMINO-6-NITROQUINOLINE |
| 4-amino-2-methyl-6-nitroquinoline |
| 4-Quinolinamine,2-methyl-6-nitro |
| 2-Methyl-6-nitro-quinolin-4-ylaMine |