1-(2-Amino-4-chlorophenyl)-2-nitroethanone structure
|
Common Name | 1-(2-Amino-4-chlorophenyl)-2-nitroethanone | ||
|---|---|---|---|---|
| CAS Number | 99233-26-8 | Molecular Weight | 214.60600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-Amino-4-chlorophenyl)-2-nitroethanone |
|---|
| Molecular Formula | C8H7ClN2O3 |
|---|---|
| Molecular Weight | 214.60600 |
| Exact Mass | 214.01500 |
| PSA | 88.91000 |
| LogP | 2.48600 |
| InChIKey | FILCGFNTVQJOPH-UHFFFAOYSA-N |
| SMILES | O=C(C[N+](=O)[O-])Nc1cccc(Cl)c1 |
|
~82%
1-(2-Amino-4-ch... CAS#:99233-26-8 |
| Literature: Kearney; Harris; Jackson; Joule Synthesis, 1992 , # 8 p. 769 - 772 |
|
~%
1-(2-Amino-4-ch... CAS#:99233-26-8 |
| Literature: Schlesinger; Prill Journal of the American Chemical Society, 1956 , vol. 78, p. 6123,6124 |
|
~%
1-(2-Amino-4-ch... CAS#:99233-26-8 |
| Literature: Kearney; Harris; Jackson; Joule Synthesis, 1992 , # 8 p. 769 - 772 |