(1R)-(+)-Fenchyl acetate structure
|
Common Name | (1R)-(+)-Fenchyl acetate | ||
|---|---|---|---|---|
| CAS Number | 99341-77-2 | Molecular Weight | 196.28600 | |
| Density | 1g/cm3 | Boiling Point | 219.8ºC at 760mmHg | |
| Molecular Formula | C12H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.4ºC | |
| Name | (1r)-(+)-fenchyl acetate, tech. 90% |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 219.8ºC at 760mmHg |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.28600 |
| Flash Point | 87.4ºC |
| Exact Mass | 196.14600 |
| PSA | 26.30000 |
| LogP | 2.76430 |
| Index of Refraction | n20/D 1.456(lit.) |
| InChIKey | JUWUWIGZUVEFQB-JBLDHEPKSA-N |
| SMILES | CC(=O)OC1C2(C)CCC(C2)C1(C)C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2915390090 |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| endo-Benzo<b>bicyclo<3.1.0>hex-2-en-4-ol |
| Cycloprop[a]inden-6-ol,1,1a,6,6a-tetrahydro |
| endo-bicyclo[2,2,1]heptan-2-ol-1,3,3-trimethyl acetate |
| MFCD00083571 |
| EINECS 237-588-5 |
| (1R)-2endo-Acetoxy-1.3.3-trimethyl-norbornan |