Hexaethyldisiloxane structure
|
Common Name | Hexaethyldisiloxane | ||
|---|---|---|---|---|
| CAS Number | 994-49-0 | Molecular Weight | 246.537 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 234.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C12H30OSi2 | Melting Point | -115°C | |
| MSDS | N/A | Flash Point | 77.0±18.8 °C | |
| Name | Hexaethyldisiloxane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 234.5±0.0 °C at 760 mmHg |
| Melting Point | -115°C |
| Molecular Formula | C12H30OSi2 |
| Molecular Weight | 246.537 |
| Flash Point | 77.0±18.8 °C |
| Exact Mass | 246.183517 |
| PSA | 9.23000 |
| LogP | 7.39 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.419 |
| InChIKey | WILBTFWIBAOWLN-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)O[Si](CC)(CC)CC |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39-S24/25-S23 |
| HS Code | 2934999090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1,1,1,3,3,3-Hexaethyldisiloxane |
| MFCD00026693 |
| Hexaethyldisiloxane |
| triethyl(triethylsilyloxy)silane |
| EINECS 213-619-8 |
| triethylsilyl ether |