2-bromo-1-(4-cyclohexylphenyl)ethanone structure
|
Common Name | 2-bromo-1-(4-cyclohexylphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 99433-28-0 | Molecular Weight | 281.18800 | |
| Density | 1.305g/cm3 | Boiling Point | 368ºC at 760mmHg | |
| Molecular Formula | C14H17BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 53.1ºC | |
| Name | 2-bromo-1-(4-cyclohexylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305g/cm3 |
|---|---|
| Boiling Point | 368ºC at 760mmHg |
| Molecular Formula | C14H17BrO |
| Molecular Weight | 281.18800 |
| Flash Point | 53.1ºC |
| Exact Mass | 280.04600 |
| PSA | 17.07000 |
| LogP | 4.31190 |
| InChIKey | JMCBGXFQNHCVBY-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1ccc(C2CCCCC2)cc1 |
| Hazard Codes | C |
|---|---|
| HS Code | 2914700090 |
|
~85%
2-bromo-1-(4-cy... CAS#:99433-28-0 |
| Literature: Kumar, R. Senthil; Kulangiappar; Kulandainathan, M. Anbu Synthetic Communications, 2010 , vol. 40, # 12 p. 1736 - 1742 |
|
~74%
2-bromo-1-(4-cy... CAS#:99433-28-0 |
| Literature: Paul, Satya; Gupta, Varinder; Gupta, Rajive; Loupy, Andre Tetrahedron Letters, 2003 , vol. 44, # 3 p. 439 - 442 |
|
~%
2-bromo-1-(4-cy... CAS#:99433-28-0 |
| Literature: Journal of the American Chemical Society, , vol. 77, p. 4054,4056 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-bromo-1-[4-(cyclohexyl)phenyl]ethanone |
| 2-bromo-4'-cyclohexylacetophenone |
| 2-Brom-1-(4-cyclohexyl-phenyl)-aethanon |
| 2-bromo-1-(4-cyclohexylphenyl)ethan-1-one |
| 2-bromanyl-1-(4-cyclohexylphenyl)ethanone |