akos b018357 structure
|
Common Name | akos b018357 | ||
|---|---|---|---|---|
| CAS Number | 99460-76-1 | Molecular Weight | 289.29700 | |
| Density | 1.55g/cm3 | Boiling Point | 357.5ºC at 760 mmHg | |
| Molecular Formula | C11H6F3NOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170ºC | |
| Name | akos b018357 |
|---|
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 357.5ºC at 760 mmHg |
| Molecular Formula | C11H6F3NOS2 |
| Molecular Weight | 289.29700 |
| Flash Point | 170ºC |
| Exact Mass | 288.98400 |
| PSA | 93.53000 |
| LogP | 3.04110 |
| Index of Refraction | 1.637 |
| InChIKey | ZXSOIGQCMUHMHG-VMPITWQZSA-N |
| SMILES | O=C1NC(=S)SC1=Cc1ccc(C(F)(F)F)cc1 |
| HS Code | 2934100090 |
|---|
|
~92%
akos b018357 CAS#:99460-76-1 |
| Literature: Shah, Sakshi; Singh, Baldev Bioorganic and Medicinal Chemistry Letters, 2012 , vol. 22, # 17 p. 5388 - 5391 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |