1,1,3,3,5,5,7,7,9,9-Decamethylpentasiloxane
1,1,3,3,5,5,7,7,9,9-Decamethylpentasiloxane structure
|
Common Name | 1,1,3,3,5,5,7,7,9,9-Decamethylpentasiloxane | ||
|---|---|---|---|---|
| CAS Number | 995-83-5 | Molecular Weight | 356.786 | |
| Density | N/A | Boiling Point | 257.1±23.0 °C at 760 mmHg | |
| Molecular Formula | C10H32O4Si5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.3±22.6 °C | |
Summary: 1,1,3,3,5,5,7,7,9,9-Decamethylpentasiloxane (CAS number: 995-83-5), molecular formula C10H32O4Si5, molecular weight 356.786. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 257.1±23.0 °C at 760 mmHg |
|---|---|
| Molecular Formula | C10H32O4Si5 |
| Molecular Weight | 356.786 |
| Flash Point | 109.3±22.6 °C |
| Exact Mass | 356.114685 |
| PSA | 36.92000 |
| LogP | 9.48 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| InChIKey | KWBVOMGZISVLGA-UHFFFAOYSA-N |
| SMILES | C[Si](C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| .1,1,2,2,3,3,4,4,5,5-Decamethyl-pentasiloxan |
| .DMPS |
| .1,1,3,3,5,5,7,7,9,9-Decamethylpentasiloxan |
| .symm.-Dekamethylpentasiloxan |
| HMD3MH |
| 1,1,3,3,5,5,7,7,9,9-decamethyl pentasiloxane |
| 1,1,3,3,5,5,7,7,9,9-Decamethylpentasiloxane |
| .1,9-Dihydro-decamethyl-pentasiloxan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane? |
| A: The English name of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane is 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane. |
| Q: What is the molecular weight of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane? |
| A: Molecular weight of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane is 356.786. |
| Q: What is the boiling point of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane? |
| A: Boiling point of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane is 257.1±23.0 °C at 760 mmHg. |
| Q: What is the InChIKey of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane? |
| A: InChIKey of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane is KWBVOMGZISVLGA-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane? |
| A: SMILES notation of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane is C[Si](C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)C. |
| Q: What English synonyms does 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane have? |
| A: English synonyms of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane: .1,1,2,2,3,3,4,4,5,5-Decamethyl-pentasiloxan, .DMPS, .1,1,3,3,5,5,7,7,9,9-Decamethylpentasiloxan, .symm.-Dekamethylpentasiloxan, HMD3MH, 1,1,3,3,5,5,7,7,9,9-decamethyl pentasiloxane, 1,1,3,3,5,5,7,7,9,9-Decamethylpentasiloxane, .1,9-Dihydro-decamethyl-pentasiloxan. |
| Q: What is the CAS number of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane? |
| A: CAS number of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane is 995-83-5. |
| Q: What is the LogP of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane? |
| A: LogP of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane is 9.48. |
| Q: What is the polar surface area (PSA) of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane? |
| A: Polar surface area (PSA) of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane is 36.92000. |
| Q: What is the molecular formula of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane? |
| A: Molecular formula of 1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxane is C10H32O4Si5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |